C16H24N10O3 — CID 24994760
2-[6-amino-8-(4-azidobutylamino)purin-9-yl]-5-(aziridin-1-ylmethyl)oxolane-3,4-diol (PubChem CID 24994760) has the molecular formula C16H24N10O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-[6-amino-8-(4-azidobutylamino)purin-9-yl]-5-(aziridin-1-ylmethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-8-(4-azidobutylamino)purin-9-yl]-5-(aziridin-1-ylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 24994760 |
| Molecular Formula | C16H24N10O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[6-amino-8-(4-azidobutylamino)purin-9-yl]-5-(aziridin-1-ylmethyl)oxolane-3,4-diol |
| SMILES | [N-]=[N+]=NCCCCNc1nc2c(N)ncnc2n1C1OC(CN2CC2)C(O)C1O |
| InChI | InChI=1S/C16H24N10O3/c17-13-10-14(21-8-20-13)26(16(23-10)19-3-1-2-4-22-24-18)15-12(28)11(27)9(29-15)7-25-5-6-25/h8-9,11-12,15,27-28H,1-7H2,(H,19,23)(H2,17,20,21) |
| InChIKey | DSPGMPBEVZELAB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 183.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|