C21H35N11O5 — CID 58918710
(2S)-2-amino-4-[[(2R,4S,5R)-5-[6-amino-8-(4-azidobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-propylamino]butanoic acid (PubChem CID 58918710) has the molecular formula C21H35N11O5 and a molecular weight of 521.58 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2R,4S,5R)-5-[6-amino-8-(4-azidobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-propylamino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2R,4S,5R)-5-[6-amino-8-(4-azidobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-propylamino]butanoic acid |
|---|---|
| PubChem CID | 58918710 |
| Molecular Formula | C21H35N11O5 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | (2S)-2-amino-4-[[(2R,4S,5R)-5-[6-amino-8-(4-azidobutylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-propylamino]butanoic acid |
| SMILES | CCCN(CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2c(NCCCCN=[N+]=[N-])nc3c(N)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C21H35N11O5/c1-2-8-31(9-5-12(22)20(35)36)10-13-15(33)16(34)19(37-13)32-18-14(17(23)26-11-27-18)29-21(32)25-6-3-4-7-28-30-24/h11-13,15-16,19,33-34H,2-10,22H2,1H3,(H,25,29)(H,35,36)(H2,23,26,27)/t12-,13+,15?,16-,19+/m0/s1 |
| InChIKey | IUYUFPCCIZCCIN-OOIRONNSSA-N |
| XLogP | 0.04 |
| TPSA | 246.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|