C16H24NO6P — CID 24999420
3-(benzoyloxymethoxycarbonylamino)butyl-propylphosphinic acid (PubChem CID 24999420) has the molecular formula C16H24NO6P and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-(benzoyloxymethoxycarbonylamino)butyl-propylphosphinic acid.
| Compound Name | 3-(benzoyloxymethoxycarbonylamino)butyl-propylphosphinic acid |
|---|---|
| PubChem CID | 24999420 |
| Molecular Formula | C16H24NO6P |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-(benzoyloxymethoxycarbonylamino)butyl-propylphosphinic acid |
| SMILES | CCCP(=O)(O)CCC(C)NC(=O)OCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24NO6P/c1-3-10-24(20,21)11-9-13(2)17-16(19)23-12-22-15(18)14-7-5-4-6-8-14/h4-8,13H,3,9-12H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | LITQMNNMNNEOEJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|