C15H19NO4S — CID 25000331
methyl (5S)-5-cyano-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoate (PubChem CID 25000331) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl (5S)-5-cyano-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoate.
| Compound Name | methyl (5S)-5-cyano-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoate |
|---|---|
| PubChem CID | 25000331 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl (5S)-5-cyano-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoate |
| SMILES | COC(=O)CCC[C@](O)(C#N)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-12-5-7-13(8-6-12)21(19)11-15(18,10-16)9-3-4-14(17)20-2/h5-8,18H,3-4,9,11H2,1-2H3/t15-,21+/m0/s1 |
| InChIKey | ZLBAGWMTDFNWSU-YCRPNKLZSA-N |
| XLogP | 1.70 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|