C13H18O4S — CID 11021957
(5R)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoic acid (PubChem CID 11021957) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (5R)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoic acid.
| Compound Name | (5R)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoic acid |
|---|---|
| PubChem CID | 11021957 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (5R)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]hexanoic acid |
| SMILES | Cc1ccc([S@](=O)C[C@H](O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-10-5-7-12(8-6-10)18(17)9-11(14)3-2-4-13(15)16/h5-8,11,14H,2-4,9H2,1H3,(H,15,16)/t11-,18-/m1/s1 |
| InChIKey | GQVOJVGVQUBTOY-ADLMAVQZSA-N |
| XLogP | 1.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |