C43H42N4O11S — CID 25000837
1,2-bis[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]cyclopropane-1,2-dicarboxylic acid (PubChem CID 25000837) has the molecular formula C43H42N4O11S and a molecular weight of 822.89 g/mol. Its IUPAC name is 1,2-bis[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]cyclopropane-1,2-dicarboxylic acid.
| Compound Name | 1,2-bis[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]cyclopropane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 25000837 |
| Molecular Formula | C43H42N4O11S |
| Molecular Weight | 822.89 g/mol |
| Exact Mass | 822.26 |
| IUPAC Name | 1,2-bis[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]cyclopropane-1,2-dicarboxylic acid |
| SMILES | COc1cc(C2C(NC(=O)c3ccc(NC(=O)C4CCCC4)cc3)(C(=O)O)C2(NC(=O)c2ccc(NC(=O)C3CCCC3)cc2)C(=O)O)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C43H42N4O11S/c1-57-32-23-28(16-21-31(32)58-39(52)33-11-6-22-59-33)34-42(40(53)54,46-37(50)26-12-17-29(18-13-26)44-35(48)24-7-2-3-8-24)43(34,41(55)56)47-38(51)27-14-19-30(20-15-27)45-36(49)25-9-4-5-10-25/h6,11-25,34H,2-5,7-10H2,1H3,(H,44,48)(H,45,49)(H,46,50)(H,47,51)(H,53,54)(H,55,56) |
| InChIKey | CVSYBKBAPIKQES-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 226.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|