C21H19N7O — CID 25001911
4-[[1-(2,3-dihydro-1H-inden-1-yl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]benzohydrazide (PubChem CID 25001911) has the molecular formula C21H19N7O and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-[[1-(2,3-dihydro-1H-inden-1-yl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]benzohydrazide.
| Compound Name | 4-[[1-(2,3-dihydro-1H-inden-1-yl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]benzohydrazide |
|---|---|
| PubChem CID | 25001911 |
| Molecular Formula | C21H19N7O |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[[1-(2,3-dihydro-1H-inden-1-yl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]benzohydrazide |
| SMILES | NNC(=O)c1ccc(Nc2ncc3cnn(C4CCc5ccccc54)c3n2)cc1 |
| InChI | InChI=1S/C21H19N7O/c22-27-20(29)14-5-8-16(9-6-14)25-21-23-11-15-12-24-28(19(15)26-21)18-10-7-13-3-1-2-4-17(13)18/h1-6,8-9,11-12,18H,7,10,22H2,(H,27,29)(H,23,25,26) |
| InChIKey | FXJKHSWDBHSHQY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|