C30H32ClN3O5S — CID 25004772
2-[3-chloro-4-[[2-ethyl-4-methyl-6-(pentylsulfonylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 25004772) has the molecular formula C30H32ClN3O5S and a molecular weight of 582.12 g/mol. Its IUPAC name is 2-[3-chloro-4-[[2-ethyl-4-methyl-6-(pentylsulfonylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[3-chloro-4-[[2-ethyl-4-methyl-6-(pentylsulfonylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 25004772 |
| Molecular Formula | C30H32ClN3O5S |
| Molecular Weight | 582.12 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 2-[3-chloro-4-[[2-ethyl-4-methyl-6-(pentylsulfonylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCCS(=O)(=O)NC(=O)c1cc(C)c2nc(CC)n(Cc3ccc(-c4ccccc4C(=O)O)cc3Cl)c2c1 |
| InChI | InChI=1S/C30H32ClN3O5S/c1-4-6-9-14-40(38,39)33-29(35)22-15-19(3)28-26(17-22)34(27(5-2)32-28)18-21-13-12-20(16-25(21)31)23-10-7-8-11-24(23)30(36)37/h7-8,10-13,15-17H,4-6,9,14,18H2,1-3H3,(H,33,35)(H,36,37) |
| InChIKey | LGUBNGSDXKBUGD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.12 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|