C30H38N2O5S — CID 25006733
1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-1-enyl]piperazine;2-hydroxyethanesulfonic acid (PubChem CID 25006733) has the molecular formula C30H38N2O5S and a molecular weight of 538.71 g/mol. Its IUPAC name is 1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-1-enyl]piperazine;2-hydroxyethanesulfonic acid.
| Compound Name | 1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-1-enyl]piperazine;2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 25006733 |
| Molecular Formula | C30H38N2O5S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 1-(2-benzhydryloxyethyl)-4-[(E)-3-phenylprop-1-enyl]piperazine;2-hydroxyethanesulfonic acid |
| SMILES | C(=C/N1CCN(CCOC(c2ccccc2)c2ccccc2)CC1)\Cc1ccccc1.O=S(=O)(O)CCO |
| InChI | InChI=1S/C28H32N2O.C2H6O4S/c1-4-11-25(12-5-1)13-10-18-29-19-21-30(22-20-29)23-24-31-28(26-14-6-2-7-15-26)27-16-8-3-9-17-27;3-1-2-7(4,5)6/h1-12,14-18,28H,13,19-24H2;3H,1-2H2,(H,4,5,6)/b18-10+; |
| InChIKey | DDSYLTMRGNPTLL-DYMYMWKRSA-N |
| XLogP | 4.03 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|