C13H16FN5O4S — CID 25011794
N-(diaminomethylidene)-2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid (PubChem CID 25011794) has the molecular formula C13H16FN5O4S and a molecular weight of 357.37 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid.
| Compound Name | N-(diaminomethylidene)-2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 25011794 |
| Molecular Formula | C13H16FN5O4S |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(diaminomethylidene)-2-(3-fluorophenyl)-5-methyl-1H-imidazole-4-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1[nH]c(-c2cccc(F)c2)nc1C(=O)N=C(N)N |
| InChI | InChI=1S/C12H12FN5O.CH4O3S/c1-6-9(11(19)18-12(14)15)17-10(16-6)7-3-2-4-8(13)5-7;1-5(2,3)4/h2-5H,1H3,(H,16,17)(H4,14,15,18,19);1H3,(H,2,3,4) |
| InChIKey | NKWCNRKPXJTVDY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|