C22H30N4O4S — CID 25017496
4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]-2-oxo-1-(sulfamoylamino)imidazolidine (PubChem CID 25017496) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]-2-oxo-1-(sulfamoylamino)imidazolidine.
| Compound Name | 4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]-2-oxo-1-(sulfamoylamino)imidazolidine |
|---|---|
| PubChem CID | 25017496 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 4-(4-tert-butylphenyl)-3-[2-(4-methoxyphenyl)ethyl]-2-oxo-1-(sulfamoylamino)imidazolidine |
| SMILES | COc1ccc(CCN2C(=O)N(NS(N)(=O)=O)CC2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-22(2,3)18-9-7-17(8-10-18)20-15-26(24-31(23,28)29)21(27)25(20)14-13-16-5-11-19(30-4)12-6-16/h5-12,20,24H,13-15H2,1-4H3,(H2,23,28,29) |
| InChIKey | ZPOIAGCJALONAW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |