C23H32O3 — CID 25019752
[(1S,3S,4R,9R,13S,15R)-3-hydroxy-5,5,9-trimethyl-12,14-dimethylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadec-10-enyl] acetate (PubChem CID 25019752) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(1S,3S,4R,9R,13S,15R)-3-hydroxy-5,5,9-trimethyl-12,14-dimethylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadec-10-enyl] acetate.
| Compound Name | [(1S,3S,4R,9R,13S,15R)-3-hydroxy-5,5,9-trimethyl-12,14-dimethylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadec-10-enyl] acetate |
|---|---|
| PubChem CID | 25019752 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [(1S,3S,4R,9R,13S,15R)-3-hydroxy-5,5,9-trimethyl-12,14-dimethylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadec-10-enyl] acetate |
| SMILES | C=C1C=C2[C@]3(C[C@@H]1C(=C)[C@H]3OC(C)=O)C[C@H](O)[C@@H]1C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C23H32O3/c1-13-10-18-22(6)9-7-8-21(4,5)19(22)17(25)12-23(18)11-16(13)14(2)20(23)26-15(3)24/h10,16-17,19-20,25H,1-2,7-9,11-12H2,3-6H3/t16-,17-,19+,20+,22-,23-/m0/s1 |
| InChIKey | SUKUJGDYDXGAGT-BFPTVKGUSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|