(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid

C14H28O3Si — CID 25023657

IUPAC(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid
SMILESCCCC[C@@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C14H28O3Si/c1-7-8-9-12(10-11-13(15)16)17-18(5,6)14(2,3)4/h10-12H,7-9H2,1-6H3,(H,15,16)/b11-10+/t12-/m0/s1
InChIKeyJZNHAVLNHPOZOC-IIANPFDCSA-N
MW272.46 g/mol
LogP4.21
Rot. Bonds7

About (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid

(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid (PubChem CID 25023657) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid.

Molecular Properties

Compound Name(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid
PubChem CID25023657
Molecular FormulaC14H28O3Si
Molecular Weight272.46 g/mol
Exact Mass272.18
IUPAC Name(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid
SMILESCCCC[C@@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C14H28O3Si/c1-7-8-9-12(10-11-13(15)16)17-18(5,6)14(2,3)4/h10-12H,7-9H2,1-6H3,(H,15,16)/b11-10+/t12-/m0/s1
InChIKeyJZNHAVLNHPOZOC-IIANPFDCSA-N
XLogP4.21
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.46
LogP ≤ 54.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid?
The IUPAC name of (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid (CID 25023657) is (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid.
What is the SMILES notation for (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid?
The canonical SMILES for (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid is CCCC[C@@H](/C=C/C(=O)O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid?
The InChIKey is JZNHAVLNHPOZOC-IIANPFDCSA-N. The full InChI is InChI=1S/C14H28O3Si/c1-7-8-9-12(10-11-13(15)16)17-18(5,6)14(2,3)4/h10-12H,7-9H2,1-6H3,(H,15,16)/b11-10+/t12-/m0/s1.
What are the key properties of (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid?
(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid has a molecular weight of 272.46 g/mol, XLogP of 4.21, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-2-enoic acid is sourced from PubChem (CID 25023657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).