C18H34O3Si — CID 46849960
(2E,7S)-7-tri(propan-2-yl)silyloxynona-2,8-dienoic acid (PubChem CID 46849960) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (2E,7S)-7-tri(propan-2-yl)silyloxynona-2,8-dienoic acid.
| Compound Name | (2E,7S)-7-tri(propan-2-yl)silyloxynona-2,8-dienoic acid |
|---|---|
| PubChem CID | 46849960 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2E,7S)-7-tri(propan-2-yl)silyloxynona-2,8-dienoic acid |
| SMILES | C=C[C@H](CCC/C=C/C(=O)O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-8-17(12-10-9-11-13-18(19)20)21-22(14(2)3,15(4)5)16(6)7/h8,11,13-17H,1,9-10,12H2,2-7H3,(H,19,20)/b13-11+/t17-/m1/s1 |
| InChIKey | FXARCDPOLBEFKB-MLFXKNMZSA-N |
| XLogP | 5.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|