C30H33IN6O — CID 25026908
1-benzyl-N-[4-[[[2-(dimethylamino)-6-iodoquinazolin-4-yl]amino]methyl]phenyl]piperidine-4-carboxamide (PubChem CID 25026908) has the molecular formula C30H33IN6O and a molecular weight of 620.54 g/mol. Its IUPAC name is 1-benzyl-N-[4-[[[2-(dimethylamino)-6-iodoquinazolin-4-yl]amino]methyl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-[4-[[[2-(dimethylamino)-6-iodoquinazolin-4-yl]amino]methyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25026908 |
| Molecular Formula | C30H33IN6O |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 1-benzyl-N-[4-[[[2-(dimethylamino)-6-iodoquinazolin-4-yl]amino]methyl]phenyl]piperidine-4-carboxamide |
| SMILES | CN(C)c1nc(NCc2ccc(NC(=O)C3CCN(Cc4ccccc4)CC3)cc2)c2cc(I)ccc2n1 |
| InChI | InChI=1S/C30H33IN6O/c1-36(2)30-34-27-13-10-24(31)18-26(27)28(35-30)32-19-21-8-11-25(12-9-21)33-29(38)23-14-16-37(17-15-23)20-22-6-4-3-5-7-22/h3-13,18,23H,14-17,19-20H2,1-2H3,(H,33,38)(H,32,34,35) |
| InChIKey | JGVVMIZDHYWMPF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|