C26H19ClN2O4S — CID 2502871
(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 2502871) has the molecular formula C26H19ClN2O4S and a molecular weight of 490.97 g/mol. Its IUPAC name is (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2502871 |
| Molecular Formula | C26H19ClN2O4S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) 1-[(2-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c2sc(C(=O)Oc3ccc4c5c(c(=O)oc4c3)CCC5)cc12 |
| InChI | InChI=1S/C26H19ClN2O4S/c1-14-20-12-23(34-24(20)29(28-14)13-15-5-2-3-8-21(15)27)26(31)32-16-9-10-18-17-6-4-7-19(17)25(30)33-22(18)11-16/h2-3,5,8-12H,4,6-7,13H2,1H3 |
| InChIKey | OLLNIWMGUJPUHP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|