C25H22ClN3O5S — CID 25041739
(4-cyanophenyl)methyl 4-chloro-3-[(2-morpholin-4-ylphenyl)sulfamoyl]benzoate (PubChem CID 25041739) has the molecular formula C25H22ClN3O5S and a molecular weight of 511.99 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-chloro-3-[(2-morpholin-4-ylphenyl)sulfamoyl]benzoate.
| Compound Name | (4-cyanophenyl)methyl 4-chloro-3-[(2-morpholin-4-ylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25041739 |
| Molecular Formula | C25H22ClN3O5S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | (4-cyanophenyl)methyl 4-chloro-3-[(2-morpholin-4-ylphenyl)sulfamoyl]benzoate |
| SMILES | N#Cc1ccc(COC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccccc3N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H22ClN3O5S/c26-21-10-9-20(25(30)34-17-19-7-5-18(16-27)6-8-19)15-24(21)35(31,32)28-22-3-1-2-4-23(22)29-11-13-33-14-12-29/h1-10,15,28H,11-14,17H2 |
| InChIKey | PYMJNFVWCVUTEU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |