C24H22N2O4S — CID 25041851
N-[(1R)-1-(3-methoxyphenyl)ethyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide (PubChem CID 25041851) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[(1R)-1-(3-methoxyphenyl)ethyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
| Compound Name | N-[(1R)-1-(3-methoxyphenyl)ethyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 25041851 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[(1R)-1-(3-methoxyphenyl)ethyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| SMILES | COc1cccc([C@@H](C)NS(=O)(=O)c2nc(-c3ccccc3)oc2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H22N2O4S/c1-17(20-14-9-15-21(16-20)29-2)26-31(27,28)24-22(18-10-5-3-6-11-18)30-23(25-24)19-12-7-4-8-13-19/h3-17,26H,1-2H3/t17-/m1/s1 |
| InChIKey | XPOFIDKXMXQNFE-QGZVFWFLSA-N |
| XLogP | 5.06 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |