C23H20N2O4S — CID 3702958
N-[(4-methoxyphenyl)methyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide (PubChem CID 3702958) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 3702958 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2nc(-c3ccccc3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O4S/c1-28-20-14-12-17(13-15-20)16-24-30(26,27)23-21(18-8-4-2-5-9-18)29-22(25-23)19-10-6-3-7-11-19/h2-15,24H,16H2,1H3 |
| InChIKey | CYEABTLXQAQZKI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |