C22H19N3O3S — CID 3783294
2,5-diphenyl-N-(2-pyridin-2-ylethyl)-1,3-oxazole-4-sulfonamide (PubChem CID 3783294) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2,5-diphenyl-N-(2-pyridin-2-ylethyl)-1,3-oxazole-4-sulfonamide.
| Compound Name | 2,5-diphenyl-N-(2-pyridin-2-ylethyl)-1,3-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 3783294 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2,5-diphenyl-N-(2-pyridin-2-ylethyl)-1,3-oxazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccccn1)c1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S/c26-29(27,24-16-14-19-13-7-8-15-23-19)22-20(17-9-3-1-4-10-17)28-21(25-22)18-11-5-2-6-12-18/h1-13,15,24H,14,16H2 |
| InChIKey | SGMAZQSKLJKCKX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |