C21H24N2O3S — CID 4254221
N-(3,3-dimethylbutan-2-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide (PubChem CID 4254221) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 4254221 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1nc(-c2ccccc2)oc1-c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H24N2O3S/c1-15(21(2,3)4)23-27(24,25)20-18(16-11-7-5-8-12-16)26-19(22-20)17-13-9-6-10-14-17/h5-15,23H,1-4H3 |
| InChIKey | RUHQGEDOSSTTMM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |