About N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide
N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide (PubChem CID 5100775) has the molecular formula C23H17F3N2O4S
and a molecular weight of 474.46 g/mol. Its IUPAC name is N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| PubChem CID | 5100775 |
| Molecular Formula | C23H17F3N2O4S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide |
| SMILES | COc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C23H17F3N2O4S/c1-31-19-13-12-17(23(24,25)26)14-18(19)28-33(29,30)22-20(15-8-4-2-5-9-15)32-21(27-22)16-10-6-3-7-11-16/h2-14,28H,1H3 |
| InChIKey | XFVOVDGEHIBLAD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
The IUPAC name of N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide (CID 5100775) is N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide.
What is the SMILES notation for N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
The canonical SMILES for N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide is COc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1nc(-c2ccccc2)oc1-c1ccccc1.
What is the InChIKey of N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
The InChIKey is XFVOVDGEHIBLAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F3N2O4S/c1-31-19-13-12-17(23(24,25)26)14-18(19)28-33(29,30)22-20(15-8-4-2-5-9-15)32-21(27-22)16-10-6-3-7-11-16/h2-14,28H,1H3.
What are the key properties of N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide?
N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide has a molecular weight of 474.46 g/mol, XLogP of 5.84, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methoxy-5-(trifluoromethyl)phenyl]-2,5-diphenyl-1,3-oxazole-4-sulfonamide is sourced from PubChem (CID 5100775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).