C26H26N2O7S — CID 25049438
[2-(4-nitrophenyl)-2-oxoethyl] 3-[(4-butylphenyl)sulfamoyl]-4-methylbenzoate (PubChem CID 25049438) has the molecular formula C26H26N2O7S and a molecular weight of 510.57 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 3-[(4-butylphenyl)sulfamoyl]-4-methylbenzoate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(4-butylphenyl)sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 25049438 |
| Molecular Formula | C26H26N2O7S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 3-[(4-butylphenyl)sulfamoyl]-4-methylbenzoate |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2cc(C(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)ccc2C)cc1 |
| InChI | InChI=1S/C26H26N2O7S/c1-3-4-5-19-7-12-22(13-8-19)27-36(33,34)25-16-21(9-6-18(25)2)26(30)35-17-24(29)20-10-14-23(15-11-20)28(31)32/h6-16,27H,3-5,17H2,1-2H3 |
| InChIKey | OODDXKLNQSWTTL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|