C11H10N4OS — CID 25052211
[3-(1,3-thiazol-2-ylamino)-1H-indazol-5-yl]methanol (PubChem CID 25052211) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is [3-(1,3-thiazol-2-ylamino)-1H-indazol-5-yl]methanol.
| Compound Name | [3-(1,3-thiazol-2-ylamino)-1H-indazol-5-yl]methanol |
|---|---|
| PubChem CID | 25052211 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [3-(1,3-thiazol-2-ylamino)-1H-indazol-5-yl]methanol |
| SMILES | OCc1ccc2[nH]nc(Nc3nccs3)c2c1 |
| InChI | InChI=1S/C11H10N4OS/c16-6-7-1-2-9-8(5-7)10(15-14-9)13-11-12-3-4-17-11/h1-5,16H,6H2,(H2,12,13,14,15) |
| InChIKey | DWLGPAFJARLTLU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |