C18H18N2O3S — CID 25052640
(E)-1-cyano-N-(2,4-dimethylphenyl)-2-(2-methoxyphenyl)ethenesulfonamide (PubChem CID 25052640) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is (E)-1-cyano-N-(2,4-dimethylphenyl)-2-(2-methoxyphenyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-N-(2,4-dimethylphenyl)-2-(2-methoxyphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 25052640 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (E)-1-cyano-N-(2,4-dimethylphenyl)-2-(2-methoxyphenyl)ethenesulfonamide |
| SMILES | COc1ccccc1/C=C(\C#N)S(=O)(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C18H18N2O3S/c1-13-8-9-17(14(2)10-13)20-24(21,22)16(12-19)11-15-6-4-5-7-18(15)23-3/h4-11,20H,1-3H3/b16-11+ |
| InChIKey | BQZYGYSIOCJWKY-LFIBNONCSA-N |
| XLogP | 3.62 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|