C17H14Cl2N2O2S — CID 25052658
(E)-1-cyano-2-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)ethenesulfonamide (PubChem CID 25052658) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is (E)-1-cyano-2-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)ethenesulfonamide.
| Compound Name | (E)-1-cyano-2-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 25052658 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (E)-1-cyano-2-(3,4-dichlorophenyl)-N-(2,4-dimethylphenyl)ethenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)/C(C#N)=C/c2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-11-3-6-17(12(2)7-11)21-24(22,23)14(10-20)8-13-4-5-15(18)16(19)9-13/h3-9,21H,1-2H3/b14-8+ |
| InChIKey | PINCULLRKDRWIA-RIYZIHGNSA-N |
| XLogP | 4.92 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|