C17H13Cl3N2O2S — CID 68946526
(Z)-1-cyano-N-(2,4-dimethylphenyl)-2-(2,3,5-trichlorophenyl)ethenesulfonamide (PubChem CID 68946526) has the molecular formula C17H13Cl3N2O2S and a molecular weight of 415.73 g/mol. Its IUPAC name is (Z)-1-cyano-N-(2,4-dimethylphenyl)-2-(2,3,5-trichlorophenyl)ethenesulfonamide.
| Compound Name | (Z)-1-cyano-N-(2,4-dimethylphenyl)-2-(2,3,5-trichlorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 68946526 |
| Molecular Formula | C17H13Cl3N2O2S |
| Molecular Weight | 415.73 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | (Z)-1-cyano-N-(2,4-dimethylphenyl)-2-(2,3,5-trichlorophenyl)ethenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)/C(C#N)=C\c2cc(Cl)cc(Cl)c2Cl)c(C)c1 |
| InChI | InChI=1S/C17H13Cl3N2O2S/c1-10-3-4-16(11(2)5-10)22-25(23,24)14(9-21)7-12-6-13(18)8-15(19)17(12)20/h3-8,22H,1-2H3/b14-7- |
| InChIKey | JOTUYWUWCJAELW-AUWJEWJLSA-N |
| XLogP | 5.57 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|