C25H21ClN2O4S — CID 19212533
(E)-N-(4-chlorophenyl)sulfonyl-2-cyano-N-(2,5-dimethylphenyl)-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 19212533) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)sulfonyl-2-cyano-N-(2,5-dimethylphenyl)-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)sulfonyl-2-cyano-N-(2,5-dimethylphenyl)-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19212533 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (E)-N-(4-chlorophenyl)sulfonyl-2-cyano-N-(2,5-dimethylphenyl)-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C(\C#N)C(=O)N(c1cc(C)ccc1C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClN2O4S/c1-17-8-9-18(2)23(14-17)28(33(30,31)22-12-10-21(26)11-13-22)25(29)20(16-27)15-19-6-4-5-7-24(19)32-3/h4-15H,1-3H3/b20-15+ |
| InChIKey | AZDHINYZTGLUFP-HMMYKYKNSA-N |
| XLogP | 5.29 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|