C19H20N6 — CID 25055461
1-cyano-2-[3-(4-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylguanidine (PubChem CID 25055461) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-cyano-2-[3-(4-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylguanidine.
| Compound Name | 1-cyano-2-[3-(4-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylguanidine |
|---|---|
| PubChem CID | 25055461 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-cyano-2-[3-(4-methylimidazol-1-yl)propyl]-3-naphthalen-1-ylguanidine |
| SMILES | Cc1cn(CCC/N=C(\NC#N)Nc2cccc3ccccc23)cn1 |
| InChI | InChI=1S/C19H20N6/c1-15-12-25(14-23-15)11-5-10-21-19(22-13-20)24-18-9-4-7-16-6-2-3-8-17(16)18/h2-4,6-9,12,14H,5,10-11H2,1H3,(H2,21,22,24) |
| InChIKey | STIHQVQNWUADQI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|