C17H24N6 — CID 167844425
1-cyano-2-[3-(dimethylamino)propyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine (PubChem CID 167844425) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-cyano-2-[3-(dimethylamino)propyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-cyano-2-[3-(dimethylamino)propyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 167844425 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-cyano-2-[3-(dimethylamino)propyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine |
| SMILES | CN(C)CCC/N=C(\NC#N)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H24N6/c1-23(2)11-5-9-19-17(22-13-18)20-10-8-14-12-21-16-7-4-3-6-15(14)16/h3-4,6-7,12,21H,5,8-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | IJPIGDPRSNBDCT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|