C25H43NO7 — CID 25058104
(2S)-2-[(2R,3S)-3-methyl-2-[(2S)-1-[(2S)-2-methyldecanoyl]pyrrolidine-2-carbonyl]oxypentanoyl]oxypropanoic acid (PubChem CID 25058104) has the molecular formula C25H43NO7 and a molecular weight of 469.62 g/mol. Its IUPAC name is (2S)-2-[(2R,3S)-3-methyl-2-[(2S)-1-[(2S)-2-methyldecanoyl]pyrrolidine-2-carbonyl]oxypentanoyl]oxypropanoic acid.
| Compound Name | (2S)-2-[(2R,3S)-3-methyl-2-[(2S)-1-[(2S)-2-methyldecanoyl]pyrrolidine-2-carbonyl]oxypentanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 25058104 |
| Molecular Formula | C25H43NO7 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | (2S)-2-[(2R,3S)-3-methyl-2-[(2S)-1-[(2S)-2-methyldecanoyl]pyrrolidine-2-carbonyl]oxypentanoyl]oxypropanoic acid |
| SMILES | CCCCCCCC[C@H](C)C(=O)N1CCC[C@H]1C(=O)O[C@@H](C(=O)O[C@@H](C)C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C25H43NO7/c1-6-8-9-10-11-12-14-18(4)22(27)26-16-13-15-20(26)24(30)33-21(17(3)7-2)25(31)32-19(5)23(28)29/h17-21H,6-16H2,1-5H3,(H,28,29)/t17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | NHPBYMFQSUHYPK-UQVNRYHBSA-N |
| XLogP | 4.34 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|