C17H33BO2Si — CID 25058448
tri(propan-2-yl)-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane (PubChem CID 25058448) has the molecular formula C17H33BO2Si and a molecular weight of 308.35 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane |
|---|---|
| PubChem CID | 25058448 |
| Molecular Formula | C17H33BO2Si |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | tri(propan-2-yl)-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane |
| SMILES | CC(C)[Si](C#CB1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H33BO2Si/c1-13(2)21(14(3)4,15(5)6)12-11-18-19-16(7,8)17(9,10)20-18/h13-15H,1-10H3 |
| InChIKey | NFKGSGUDVJBYJG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|