C17H30O3Si — CID 25058922
(3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-3-pent-3-ynyloxolan-2-one (PubChem CID 25058922) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-3-pent-3-ynyloxolan-2-one.
| Compound Name | (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-3-pent-3-ynyloxolan-2-one |
|---|---|
| PubChem CID | 25058922 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (3R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-3-pent-3-ynyloxolan-2-one |
| SMILES | CC#CCC[C@]1(C)C[C@@H](CO[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C17H30O3Si/c1-8-9-10-11-17(5)12-14(20-15(17)18)13-19-21(6,7)16(2,3)4/h14H,10-13H2,1-7H3/t14-,17+/m0/s1 |
| InChIKey | NFTRIJBEAMDNFW-WMLDXEAASA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|