C20H12BrClF3N3 — CID 25061702
2-[4-[5-(bromomethyl)-3-chloro-2-pyridinyl]phenyl]-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 25061702) has the molecular formula C20H12BrClF3N3 and a molecular weight of 466.69 g/mol. Its IUPAC name is 2-[4-[5-(bromomethyl)-3-chloro-2-pyridinyl]phenyl]-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-[4-[5-(bromomethyl)-3-chloro-2-pyridinyl]phenyl]-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 25061702 |
| Molecular Formula | C20H12BrClF3N3 |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 2-[4-[5-(bromomethyl)-3-chloro-2-pyridinyl]phenyl]-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)c1ccc2nc(-c3ccc(-c4ncc(CBr)cc4Cl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C20H12BrClF3N3/c21-9-11-7-15(22)18(26-10-11)12-1-3-13(4-2-12)19-27-16-6-5-14(20(23,24)25)8-17(16)28-19/h1-8,10H,9H2,(H,27,28) |
| InChIKey | WYINUGNGTQAKGE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|