C24H22ClN3 — CID 25061706
6-tert-butyl-2-[4-(3-chloro-5-ethenyl-2-pyridinyl)phenyl]-1H-benzimidazole (PubChem CID 25061706) has the molecular formula C24H22ClN3 and a molecular weight of 387.91 g/mol. Its IUPAC name is 6-tert-butyl-2-[4-(3-chloro-5-ethenyl-2-pyridinyl)phenyl]-1H-benzimidazole.
| Compound Name | 6-tert-butyl-2-[4-(3-chloro-5-ethenyl-2-pyridinyl)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 25061706 |
| Molecular Formula | C24H22ClN3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-tert-butyl-2-[4-(3-chloro-5-ethenyl-2-pyridinyl)phenyl]-1H-benzimidazole |
| SMILES | C=Cc1cnc(-c2ccc(-c3nc4ccc(C(C)(C)C)cc4[nH]3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H22ClN3/c1-5-15-12-19(25)22(26-14-15)16-6-8-17(9-7-16)23-27-20-11-10-18(24(2,3)4)13-21(20)28-23/h5-14H,1H2,2-4H3,(H,27,28) |
| InChIKey | VQNXSYXBGXLCPS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |