C23H31ClN4O — CID 163966385
N'-[3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)-2-chlorophenoxy]propyl]-N-methylethane-1,2-diamine (PubChem CID 163966385) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is N'-[3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)-2-chlorophenoxy]propyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)-2-chlorophenoxy]propyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 163966385 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N'-[3-[4-(6-tert-butyl-1H-benzimidazol-2-yl)-2-chlorophenoxy]propyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCCCOc1ccc(-c2nc3ccc(C(C)(C)C)cc3[nH]2)cc1Cl |
| InChI | InChI=1S/C23H31ClN4O/c1-23(2,3)17-7-8-19-20(15-17)28-22(27-19)16-6-9-21(18(24)14-16)29-13-5-10-26-12-11-25-4/h6-9,14-15,25-26H,5,10-13H2,1-4H3,(H,27,28) |
| InChIKey | SMDUTCAUFFJXNI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|