C21H28N4 — CID 59530582
2-(4-tert-butylphenyl)-5-N,5-N-diethyl-1H-benzimidazole-5,6-diamine (PubChem CID 59530582) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-N,5-N-diethyl-1H-benzimidazole-5,6-diamine.
| Compound Name | 2-(4-tert-butylphenyl)-5-N,5-N-diethyl-1H-benzimidazole-5,6-diamine |
|---|---|
| PubChem CID | 59530582 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-N,5-N-diethyl-1H-benzimidazole-5,6-diamine |
| SMILES | CCN(CC)c1cc2nc(-c3ccc(C(C)(C)C)cc3)[nH]c2cc1N |
| InChI | InChI=1S/C21H28N4/c1-6-25(7-2)19-13-18-17(12-16(19)22)23-20(24-18)14-8-10-15(11-9-14)21(3,4)5/h8-13H,6-7,22H2,1-5H3,(H,23,24) |
| InChIKey | XXJNYPNQQHWYEC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|