C21H26N8 — CID 25063042
N-[(1-butyltetrazol-5-yl)-quinolin-2-ylmethyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 25063042) has the molecular formula C21H26N8 and a molecular weight of 390.50 g/mol. Its IUPAC name is N-[(1-butyltetrazol-5-yl)-quinolin-2-ylmethyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[(1-butyltetrazol-5-yl)-quinolin-2-ylmethyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 25063042 |
| Molecular Formula | C21H26N8 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[(1-butyltetrazol-5-yl)-quinolin-2-ylmethyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CCCCn1nnnc1C(NCCCn1ccnc1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H26N8/c1-2-3-14-29-21(25-26-27-29)20(23-11-6-13-28-15-12-22-16-28)19-10-9-17-7-4-5-8-18(17)24-19/h4-5,7-10,12,15-16,20,23H,2-3,6,11,13-14H2,1H3 |
| InChIKey | LUOWPXCFSFCQSF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|