C34H59N7O22 — CID 25063923
2-[bis[2-[carboxymethyl-[2-oxo-2-[2-[2-[(E)-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexylidene]amino]oxyacetyl]oxyethylamino]ethyl]amino]ethyl]amino]acetic acid (PubChem CID 25063923) has the molecular formula C34H59N7O22 and a molecular weight of 917.87 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-[2-[2-[(E)-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexylidene]amino]oxyacetyl]oxyethylamino]ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[2-[2-[(E)-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexylidene]amino]oxyacetyl]oxyethylamino]ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 25063923 |
| Molecular Formula | C34H59N7O22 |
| Molecular Weight | 917.87 g/mol |
| Exact Mass | 917.37 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-[2-[2-[(E)-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexylidene]amino]oxyacetyl]oxyethylamino]ethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)NCCOC(=O)CO/N=C/C[C@@H](O)[C@@H](O)[C@H](O)CO)CCN(CC(=O)O)CC(=O)NCCOC(=O)CO/N=C/C[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C34H59N7O22/c42-18-24(46)33(58)22(44)1-3-37-62-20-31(56)60-11-5-35-26(48)13-40(16-29(52)53)9-7-39(15-28(50)51)8-10-41(17-30(54)55)14-27(49)36-6-12-61-32(57)21-63-38-4-2-23(45)34(59)25(47)19-43/h3-4,22-25,33-34,42-47,58-59H,1-2,5-21H2,(H,35,48)(H,36,49)(H,50,51)(H,52,53)(H,54,55)/b37-3+,38-4+/t22-,23-,24-,25-,33-,34-/m1/s1 |
| InChIKey | ZJECBLWAKCLSBJ-MEDGMMFESA-N |
| XLogP | -8.60 |
| TPSA | 437.44 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.87 |
| LogP ≤ 5 | -8.60 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|