C23H32N2O6 — CID 25064469
(3R)-3-[[5-[(2-methoxy-4-propylphenoxy)methyl]furan-3-carbonyl]amino]-4-(trimethylazaniumyl)butanoate (PubChem CID 25064469) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is (3R)-3-[[5-[(2-methoxy-4-propylphenoxy)methyl]furan-3-carbonyl]amino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-[[5-[(2-methoxy-4-propylphenoxy)methyl]furan-3-carbonyl]amino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 25064469 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (3R)-3-[[5-[(2-methoxy-4-propylphenoxy)methyl]furan-3-carbonyl]amino]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCc1ccc(OCc2cc(C(=O)N[C@H](CC(=O)[O-])C[N+](C)(C)C)co2)c(OC)c1 |
| InChI | InChI=1S/C23H32N2O6/c1-6-7-16-8-9-20(21(10-16)29-5)31-15-19-11-17(14-30-19)23(28)24-18(12-22(26)27)13-25(2,3)4/h8-11,14,18H,6-7,12-13,15H2,1-5H3,(H-,24,26,27,28)/t18-/m1/s1 |
| InChIKey | QXTGNKHOWBSDKV-GOSISDBHSA-N |
| XLogP | 1.76 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|