C13H11O5- — CID 7446735
5-[(2-methoxyphenoxy)methyl]furan-3-carboxylate (PubChem CID 7446735) has the molecular formula C13H11O5- and a molecular weight of 247.23 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]furan-3-carboxylate.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 7446735 |
| Molecular Formula | C13H11O5- |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]furan-3-carboxylate |
| SMILES | COc1ccccc1OCc1cc(C(=O)[O-])co1 |
| InChI | InChI=1S/C13H12O5/c1-16-11-4-2-3-5-12(11)18-8-10-6-9(7-17-10)13(14)15/h2-7H,8H2,1H3,(H,14,15)/p-1 |
| InChIKey | FSDGPLUOJFBNLG-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 71.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |