C13H14Cl2N2O3 — CID 25067471
1-(3,4-dihydroxyphenyl)-2-(pyridin-4-ylamino)ethanone;dihydrochloride (PubChem CID 25067471) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(pyridin-4-ylamino)ethanone;dihydrochloride.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(pyridin-4-ylamino)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 25067471 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(pyridin-4-ylamino)ethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CNc1ccncc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H12N2O3.2ClH/c16-11-2-1-9(7-12(11)17)13(18)8-15-10-3-5-14-6-4-10;;/h1-7,16-17H,8H2,(H,14,15);2*1H |
| InChIKey | PXBOPSZCVOANEQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|