C16H12Cl2N8 — CID 25068173
3,6-bis[(6-chloro-3-pyridinyl)methyl]triazolo[4,5-d]pyrimidin-7-imine (PubChem CID 25068173) has the molecular formula C16H12Cl2N8 and a molecular weight of 387.23 g/mol. Its IUPAC name is 3,6-bis[(6-chloro-3-pyridinyl)methyl]triazolo[4,5-d]pyrimidin-7-imine.
| Compound Name | 3,6-bis[(6-chloro-3-pyridinyl)methyl]triazolo[4,5-d]pyrimidin-7-imine |
|---|---|
| PubChem CID | 25068173 |
| Molecular Formula | C16H12Cl2N8 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3,6-bis[(6-chloro-3-pyridinyl)methyl]triazolo[4,5-d]pyrimidin-7-imine |
| SMILES | [H]/N=c1/c2nnn(Cc3ccc(Cl)nc3)c2ncn1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H12Cl2N8/c17-12-3-1-10(5-20-12)7-25-9-22-16-14(15(25)19)23-24-26(16)8-11-2-4-13(18)21-6-11/h1-6,9,19H,7-8H2/b19-15- |
| InChIKey | GENBSIKLZIWAMM-CYVLTUHYSA-N |
| XLogP | 2.30 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|