C26H38O12 — CID 25068248
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E,4S)-4-acetyloxy-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate (PubChem CID 25068248) has the molecular formula C26H38O12 and a molecular weight of 542.58 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E,4S)-4-acetyloxy-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E,4S)-4-acetyloxy-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 25068248 |
| Molecular Formula | C26H38O12 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2E,4S)-4-acetyloxy-3,7-dimethylocta-2,6-dienoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC/C=C(\C)[C@H](CC=C(C)C)OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O12/c1-14(2)9-10-21(34-17(5)28)15(3)11-12-32-26-25(37-20(8)31)24(36-19(7)30)23(35-18(6)29)22(38-26)13-33-16(4)27/h9,11,21-26H,10,12-13H2,1-8H3/b15-11+/t21-,22+,23+,24-,25+,26+/m0/s1 |
| InChIKey | DPZUHXLOXSLJRB-ZEYVAANLSA-N |
| XLogP | 2.32 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|