C13H17IO4 — CID 25091419
(1S,3R,4R,7S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 25091419) has the molecular formula C13H17IO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is (1S,3R,4R,7S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
| Compound Name | (1S,3R,4R,7S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 25091419 |
| Molecular Formula | C13H17IO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (1S,3R,4R,7S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | O=C1[C@H]2C=C(I)[C@H](C[C@@H]2OCCCCO)[C@@]12CO2 |
| InChI | InChI=1S/C13H17IO4/c14-10-5-8-11(17-4-2-1-3-15)6-9(10)13(7-18-13)12(8)16/h5,8-9,11,15H,1-4,6-7H2/t8-,9-,11-,13-/m0/s1 |
| InChIKey | XSHRZDCLRVNXBY-PZEZNAACSA-N |
| XLogP | 1.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|