C16H13NO2S2 — CID 2509365
(2-phenyl-1,3-thiazol-4-yl)methyl 2-thiophen-3-ylacetate (PubChem CID 2509365) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-thiophen-3-ylacetate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 2509365 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-thiophen-3-ylacetate |
| SMILES | O=C(Cc1ccsc1)OCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13NO2S2/c18-15(8-12-6-7-20-10-12)19-9-14-11-21-16(17-14)13-4-2-1-3-5-13/h1-7,10-11H,8-9H2 |
| InChIKey | UALGUZGMAQWKPZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |