C16H9NO2S2 — CID 154585865
3-(2-thiophen-2-yl-1,3-thiazol-4-yl)isochromen-1-one (PubChem CID 154585865) has the molecular formula C16H9NO2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)isochromen-1-one.
| Compound Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)isochromen-1-one |
|---|---|
| PubChem CID | 154585865 |
| Molecular Formula | C16H9NO2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)isochromen-1-one |
| SMILES | O=c1oc(-c2csc(-c3cccs3)n2)cc2ccccc12 |
| InChI | InChI=1S/C16H9NO2S2/c18-16-11-5-2-1-4-10(11)8-13(19-16)12-9-21-15(17-12)14-6-3-7-20-14/h1-9H |
| InChIKey | KAUYRLDCLHQVAP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |