C16H11NO2S2 — CID 154454613
3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2H-chromen-7-ol (PubChem CID 154454613) has the molecular formula C16H11NO2S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2H-chromen-7-ol.
| Compound Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 154454613 |
| Molecular Formula | C16H11NO2S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2H-chromen-7-ol |
| SMILES | Oc1ccc2c(c1)OCC(c1csc(-c3cccs3)n1)=C2 |
| InChI | InChI=1S/C16H11NO2S2/c18-12-4-3-10-6-11(8-19-14(10)7-12)13-9-21-16(17-13)15-2-1-5-20-15/h1-7,9,18H,8H2 |
| InChIKey | ARWCNYJQGIMCTH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |