C22H27N3O4 — CID 25095105
[4-(1-adamantylmethylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl ethaneperoxoate (PubChem CID 25095105) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [4-(1-adamantylmethylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl ethaneperoxoate.
| Compound Name | [4-(1-adamantylmethylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl ethaneperoxoate |
|---|---|
| PubChem CID | 25095105 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [4-(1-adamantylmethylcarbamoyl)pyrazolo[1,5-a]pyridin-2-yl]methyl ethaneperoxoate |
| SMILES | CC(=O)OOCc1cc2c(C(=O)NCC34CC5CC(CC(C5)C3)C4)cccn2n1 |
| InChI | InChI=1S/C22H27N3O4/c1-14(26)29-28-12-18-8-20-19(3-2-4-25(20)24-18)21(27)23-13-22-9-15-5-16(10-22)7-17(6-15)11-22/h2-4,8,15-17H,5-7,9-13H2,1H3,(H,23,27) |
| InChIKey | OOCQHOUCCFHWLN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|