C21H24O3S — CID 25098920
(1'R,6'S,7'S)-9'-methyl-9'-phenylsulfanylspiro[1,3-dioxolane-2,4'-8-oxatricyclo[5.3.3.01,6]trideca-2,11-diene] (PubChem CID 25098920) has the molecular formula C21H24O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is (1'R,6'S,7'S)-9'-methyl-9'-phenylsulfanylspiro[1,3-dioxolane-2,4'-8-oxatricyclo[5.3.3.01,6]trideca-2,11-diene].
| Compound Name | (1'R,6'S,7'S)-9'-methyl-9'-phenylsulfanylspiro[1,3-dioxolane-2,4'-8-oxatricyclo[5.3.3.01,6]trideca-2,11-diene] |
|---|---|
| PubChem CID | 25098920 |
| Molecular Formula | C21H24O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (1'R,6'S,7'S)-9'-methyl-9'-phenylsulfanylspiro[1,3-dioxolane-2,4'-8-oxatricyclo[5.3.3.01,6]trideca-2,11-diene] |
| SMILES | CC1(Sc2ccccc2)C[C@]23C=CC[C@H](O1)[C@H]2CC1(C=C3)OCCO1 |
| InChI | InChI=1S/C21H24O3S/c1-19(25-16-6-3-2-4-7-16)15-20-9-5-8-18(24-19)17(20)14-21(11-10-20)22-12-13-23-21/h2-7,9-11,17-18H,8,12-15H2,1H3/t17-,18+,19?,20-/m1/s1 |
| InChIKey | IANQAVFGTNGXDI-JIRNRHONSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|